Cytarabine HCl
Cytarabine HCl is the hydrochloride form of Cytarabine. Cytarabine (Ara-C) is an antineoplastic and antileukemic agent in current clinical treatment.
| Trivial name | Cytosine β-D-arabinofuranoside HCl; Cytosine beta-D-arabinofuranoside HCl; Cytosine Arabinoside HCl |
| Catalog Number | CSN10734 |
| Alternative Name(s) | Cytosine β-D-arabinofuranoside HCl; Cytosine beta-D-arabinofuranoside HCl; Cytosine Arabinoside HCl |
| Research Area | Cancer |
| Molecular Formula | C9H14ClN3O5 |
| CAS# | 69-74-9 |
| Purity | ≥99% |
| SMILES | O=C1N=C(N)C=CN1[C@@H]2[C@@H]([C@H]([C@H](CO)O2)O)O.[H]Cl |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/cytarabine-hcl.html |