D-Mannitol
Carbohydrates
| Trivial name | NULL |
| Catalog Number | CS-T-31547 |
| Alternative Name(s) | Cordycepic Acid;Cordycepic Acid |
| Research Area | D-Mannitol is widespread in plants and plant exudates; obtained from manna and seaweeds. D-Mannitol is used in the food industry as anticaking and free-flow agent, flavoring agent, lubricant and release agent, stabilizer and thickener and nutritive sweetener. |
| Molecular Formula | C6H14O6 |
| CAS# | 69-65-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@H]([C@H](O)CO)[C@H](O)[C@H](O)CO |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST31547.html |
| Additional Information | NULL |