Chlorpromazine HCl 10mM * 1mL in DMSO
Chlorpromazine is a dopamine antagonist of the typical antipsychotic class of medications possessing additional antiadrenergic, antiserotonergic, anticholinergic and antihistaminergic properties used to treat schizophrenia.
| Trivial name | Chlorpromazine HCl 10mM * 1mL in DMSO |
| Catalog Number | A10206-10mM-D |
| Alternative Name(s) | 2-Chloro-10-(3-dimethylaminopropyl)phenothiazine hydrochloride |
| Molecular Formula | C17H19ClN2S.HCl |
| CAS# | 69-09-0 |
| SMILES | CN(C)CCCN1C2=CC=CC=C2SC3=C1C=C(C=C3)Cl.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/chlorpromazine-hydrochloride.html |