Triiodothyronine
Triiodothyronine is a thyroid hormone generated by deiodination of the prohormone thyroxine (T4) and is a potent agonist of both thyroid hormone receptors TRα and TRβ (Kis = 2.3 nM for both).
| Trivial name | T3; L-3,3',5-Triiodothyronine; Liothyronine; Tresitope |
| Catalog Number | CSN12771 |
| Alternative Name(s) | T3; L-3,3',5-Triiodothyronine; Liothyronine; Tresitope |
| Research Area | Endocrinology |
| Molecular Formula | C15H12I3NO4 |
| CAS# | 6893-02-3 |
| Purity | ≥98% |
| SMILES | O=C(O)[C@@H](N)CC1=CC(I)=C(OC2=CC=C(O)C(I)=C2)C(I)=C1 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/triiodothyronine.html |