Piroctone olamine
Piroctone olamine is a compound sometimes used in the treatment of fungal infections. Piroctone olamine is the ethanolamine salt of the hydroxamic acid derivative piroctone.
| Catalog Number | T0721 |
| Alternative Name(s) | Piroctone ethanolamine |
| Research Area | Microbiology/Virology |
| Molecular Formula | C16H30N2O3 |
| CAS# | 68890-66-4 |
| Purity | 99.50% |
| SMILES | Cc1cc(CC(C)CC(C)(C)C)n(O)c(=O)c1.NCCO |
| Size | 200 mg |
| Supplier Page | https://www.targetmol.com/compound/Piroctone olamine |
| Additional Information | https://www.targetmol.com/datasheet/T0721 |