Sophoridine
Sophoridine is naturally occuring alkaloid found in the plant Sophora flavescens, which could suppresses cell growth of human medulloblastoma through the inhibition of the FoxM1, NF‑κB and AP‑1 signaling pathway.
| Trivial name | Matrine |
| Catalog Number | CSN20630 |
| Alternative Name(s) | Matrine |
| Research Area | / |
| Molecular Formula | C15H24N2O |
| CAS# | 6882-68-4 |
| Purity | ≥99% |
| SMILES | O=C1CCC[C@]2([H])[C@@]3([H])CCCN4[C@@]3([H])[C@@](CCC4)([H])CN21 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/sophoridine.html |