IWP-2 10mM * 1mL in DMSO
IWP-2 is an inactivator of Porcn function and inhibitor of Wnt production, and blocks beta-catenin accumulation. Wnt/b-catenin (‘canonical’) pathway maintains transcriptional programs that enable stem cells to remain multipotent.
| Trivial name | IWP-2 10mM * 1mL in DMSO |
| Catalog Number | A12707-10mM-D |
| Alternative Name(s) | N-(6-Methyl-2-benzothiazolyl)-2-[(3,4,6,7-tetrahydro-4-oxo-3-phenylthieno[3,2-d]pyrimidin-2-yl)thio]-acetamide |
| Molecular Formula | C22H18N4O2S3 |
| CAS# | 686770-61-6 |
| SMILES | CC1=CC2=C(C=C1)N=C(S2)NC(=O)CSC3=NC4=C(C(=O)N3C5=CC=CC=C5)SCC4 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/iwp-2.html |
