Cocoamido propyl dimethyl amine
A surfactant with a positively charged head that has good foaming properties and can be used in cleansing products both for the skin and the hair.
| Catalog Number | CDC10-0373 |
| Alternative Name(s) | (1R,2S,5R)-2-Isopropyl-N-(4-methoxyphenyl)-5-methylcyclohexanecarboxamide |
| Research Area | Used for research and manufacturing |
| Molecular Formula | C18H27NO2 |
| CAS# | 68489-09-8 |
| Inchi | 1S/C18H27NO2/c1-12(2)16-10-5-13(3)11-17(16)18(20)19-14-6-8-15(21-4)9-7-14/h6-9,12-13,16-17H,5,10-11H2,1-4H3,(H,19,20)/t13-,16?,17?/m1/s1 |
| SMILES | COc1ccc(NC(=O)C2C[C@H](C)CC[C@H]2C(C)C)cc1 |
| Size | inquire |
| Supplier Page | https://www.formulationbio.com/cocoamido-propyl-dimethyl-amine-item-2455.html |