Homovanillic acid-d3-1 | MedChemExpress (MCE)
Homovanillic acid-d3-1 (Vanilacetic acid-d3-1) is deuterated labeled Homovanillic acid (HY-N0384). Homovanillic acid is a dopamine metabolite associated with aromatic amino acid decarboxylase deficiency, celiac disease, growth hormone deficiency, and adiponectin reductase deficiency[1].
| Trivial name | Homovanillic acid-d3-1 |
| Catalog Number | HY-N0384S4 |
| Alternative Name(s) | Vanilacetic acid-d3-1 |
| Research Area | Metabolic Disease |
| CAS# | 68408-02-6 |
| Purity | ≥98.0% |
| SMILES | O=C(O)CC1=C([2H])C([2H])=C(O)C(OC)=C1[2H] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/homovanillic-acid-d3-1.html |