Ceftizoxime
Ceftizoxime is a third-generation cephalosporin antibiotic, which is is highly resistant to a broad spectrum of β-lactamases and is active against a wide range of both aerobic and anaerobic gram-positive and gram-negative organisms.
| Trivial name | / |
| Catalog Number | CSN10018 |
| Alternative Name(s) | / |
| Research Area | Infection |
| Molecular Formula | C13H13N5O5S2 |
| CAS# | 68401-81-0 |
| Purity | ≥98% |
| SMILES | O=C(C(N12)=CCS[C@]2([H])[C@H](NC(/C(C3=CSC(N)=N3)=N\OC)=O)C1=O)O |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/ceftizoxime.html |