Zonisamide Sodium
Zonisamide sodium is a 1,2 benzisoxazole derivative and the first agent of this chemical class to be developed as an antiepileptic drug.
| Trivial name | AD 810 Sodium; CI-912 Sodium |
| Catalog Number | CSN18390 |
| Alternative Name(s) | AD 810 Sodium; CI-912 Sodium |
| Research Area | Neurological Disease |
| Molecular Formula | C8H7N2NaO3S |
| CAS# | 68291-98-5 |
| Purity | ≥98% |
| SMILES | O=S(CC1=NOC2=C1C=CC=C2)(N)=O.[Na+] |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/zonisamide-sodium.html |