EBOV-IN-5 | MedChemExpress (MCE)
EBOV-IN-5 (compound 14) is an antiviral agent that inhibits Ebola virus (EBOV) infection. EBOV-IN-5 inhibits the binding of the EBOV glycoprotein EBOV-GPcl to NPC1, an indispensable host receptor required for viral fusion/entry.[7][1].
| Trivial name | EBOV-IN-5 |
| Catalog Number | HY-160880 |
| Research Area | Infection |
| CAS# | 68207-15-8 |
| Purity | ≥98.0% |
| SMILES | O=C(CN(CC)CC)NNC1=C(SC2=CC(Cl)=CC=C2[N+]([O-])=O)C=CC=C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ebov-in-5.html |