δ-Viniferin | MedChemExpress (MCE)
δ-Viniferin is a resveratrol dehydrodimer, an isomer of ε-Viniferin (HY-N3841)[1]. ε-Viniferin (epsilon-Viniferin), the dimer of Resveratrol, displays a potent inhibitory for all the CYP activities, with Ki values from 0.5-20 μM. ε-Viniferin possesses potent antioxidant, anti-inflammatory, anti-diabetic, and anti-neurodegenerative capacity.
| Trivial name | δ-Viniferin |
| Catalog Number | HY-N3841A |
| Research Area | Metabolic Disease |
| CAS# | 681293-15-2 |
| Purity | ≥98.00% |
| SMILES | OC1=CC(O)=CC(/C=C/C2=CC=C3O[C@H](C4=CC=C(C=C4)O)[C@@H](C5=CC(O)=CC(O)=C5)C3=C2)=C1 |
| PubChem Chemical Structure ID | 10095474 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/δ-viniferin.html |