N-Acetyl-L-proline
Amino Acids and Derivatives
| Trivial name | NULL |
| Catalog Number | CS-O-30988 |
| Alternative Name(s) | (S)-1-acetylpyrrolidine-2-carboxylic acid |
| Research Area | N-Acetyl-L-proline is an aminoacid used in the synthesis of pharmaceutical compounds useful in preventing and treating disorders and syndromes associated with the nervous, vascular, musculoskeletal, or cutaneous systems. |
| Molecular Formula | C7H11NO3 |
| CAS# | 68-95-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC([C@H](CCC1)N1C(C)=O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30988.html |
| Additional Information | NULL |