Vitamin B12
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-01152 |
| Alternative Name(s) | Vitamin B 12;Cobalamin;cobalt(3+) ion (1R,2R,3R,4R,6Z,8S,11Z,13S,14S,16Z,18S,19S)- 8,13,18-tris(2- tr-4-(2-{[(2R)-2- {[(2R,3S,4R,5S)-5-(5,6-dimethyl-1H-1,3-benzodiazol-1- yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl phosphonato]oxy}propylcarbamoyl}ethyl)- 1,4,6,9,9,14,16,19-ctamethyl-20,21,22,23- tetraazapentcclo[15.2.1.1?,5.17,.1,5]trcosa- 5(23),6,10(22),11,15(21),16-hexaen-20-ide iminomethanidecobaltc;[(2R,3S,4R,5S)-5-(5,6-dimethylbenzimidazol-1-yl)-4-hydroxy-2-(hydroxymethyl)tetrahydrofuran-3-yl] [(1R)-1-methyl-2-[3-[(1R,2R,3R,4Z,7S,9Z,12S,13S,14Z,17S,18S,19R)-2,13,18-tris(2-amino-2-oxo-ethyl)-7,12,17-tris(3-amino-3-oxo-propyl)-3,5,8,8,13,15,18,19-ctamethyl-2,7,12,17-tetrahydro-1Hcorrin-21-id-3-yl]propanoylamino]ethyl] phosphatecyanide.cyancobalamine |
| Research Area | Prototype of the family of naturally occurring cobalt coordination compounds knows as corrinoids. Analogs of vitamin B12 which differ only in the β-ligand of the cobalt are termed cobalamins. Synthesized almost exclusively by bacteria. Dietary sources include fish, meat, liver, and dairy products; plants have little or no cobalamins. Converted by the body into its bioactive forms, methylcobalamin and cobamamide, which serve as enzyme cofactors. Severe deficiency may result in megaloblastic anemia and/or neurological impairment. |
| Molecular Formula | C63H8CoN14O14P |
| CAS# | 68-19-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | N#[C-][Co+3]123([N]4=CN(C(OC(CO)C5O[P]6([O-])=O)C5O)C7=C4C=C(C)C(C)=C7)[N]8=C9C(CCC(N)=O)C(CC(N)=O)(C)C8(C)C(C(CC(N)=O)C%10(CCC(NCC(C)O6)=O)C)[N-]1C%10=C(C)C(C(CCC(N)=O)C%11(C)C)=[N]2C%11=CC%12=[N]3C(C(CC(N)=O)(C)C%12CCC(N)=O)=C9C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01152.html |
| Additional Information | NULL |
