Sodium Danshensu
Sodium danshensu is a mono sodium of danshensu, which is a natural phenolic acid of caffeic acid derivatives isolated from Salvia miltiorrhiza.
| Trivial name | Danshensu Sodium Salt |
| Catalog Number | CSN16467 |
| Alternative Name(s) | Danshensu Sodium Salt |
| Research Area | / |
| Molecular Formula | C9H9NaO5 |
| CAS# | 67920-52-9 |
| Purity | ≥99% |
| SMILES | O=C([O-])C(O)CC1=CC=C(O)C(O)=C1.[Na+] |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/sodium-danshensu.html |