1-Azakenpaullone 10mM * 1mL in DMSO
1-Azakenpaullone is a potent and selective GSK-3?? inhibitor with IC50 of 18 nM, >100-fold selectivity over CDK1/cyclin B and CDK5/p25.
| Trivial name | 1-Azakenpaullone 10mM * 1mL in DMSO |
| Catalog Number | A14303-10mM-D |
| Alternative Name(s) | Pyrido[3',2':2,3]azepino[4,5-b]indol-6(5H)-one, 9-bromo-7,12-dihydro- |
| Molecular Formula | C15H10BrN3O |
| CAS# | 676596-65-9 |
| SMILES | C1C2=C(C3=C(C=CC=N3)NC1=O)NC4=C2C=C(C=C4)Br |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/1-azakenpaullone.html |