Nutlin 3a 5mg
Nutlin 3a is a potent inhibitor of MDM2 (mouse double minute 2) binding to p53 that induces the expression of p53 regulated genes, and shows potent antiproliferative activity in cells expressing functional p53.
| Trivial name | Nutlin 3a 5mg |
| Catalog Number | A11501-5 |
| Alternative Name(s) | 4-[[(4S,5R)-4,5-Bis(4-chlorophenyl)-2-(2-isopropoxy-4-methoxyphenyl)-4,5-dihydroimidazol-1-yl]carbonyl]piperazin-2-one |
| Molecular Formula | C30H30Cl2N4O4 |
| CAS# | 675576-98-4 |
| SMILES | CC(C)OC1=C(C=CC(=C1)OC)C2=N[C@H]([C@H](N2C(=O)N3CCNC(=O)C3)C4=CC=C(C=C4)Cl)C5=CC=C(C=C5)Cl |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/nutlin-3a.html |
