Xanthohumol
Xanthohumol, a prenylated chalcone from hop, inhibits COX-1 andCOX-2 activity and shows chemopreventive effects. Xanthohumol inhibits diacylglycerol acyltransferase 1 (DGAT1) and DGAT2 with both IC50 of 40 μM. Xanthohumol is also a potent antiviral agent against a series of DNA and RNA viruses. Xanthohumol induces growth inhibition and apoptosis in cancer cells. Phase 1.
| Trivial name | N/A |
| Catalog Number | S7889 |
| Molecular Formula | C21H22O5 |
| CAS# | 6754-58-1 |
| Inchi | InChI=1S/C21H22O5/c1-13(2)4-10-16-18(24)12-19(26-3)20(21(16)25)17(23)11-7-14-5-8-15(22)9-6-14/h4-9,11-12,22,24-25H,10H2,1-3H3/b11-7+ |
| Inchi Key | ORXQGKIUCDPEAJ-YRNVUSSQSA-N |
| SMILES | CC(=CCC1=C(C(=C(C=C1O)OC)C(=O)C=CC2=CC=C(C=C2)O)O)C |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/xanthohumol.html |
| Additional Information | https://file.selleck.cn/downloads/struct/xanthohumol-chemical-structure-s7889.gif |