Morphine D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-57101 |
| Alternative Name(s) | (5a,6a)-7,8-Didehydro-4,5-epoxy-17-(methyl-d3)morphinan-3,6-diol; (-)-Morphine-d3; Aguettant-d3; Morphia-d3; Morphina-d3; Nepenthe-d3; Ospalivina-d3; l-Morphine-d3; |
| Research Area | Morphine-d3, is the labeled analogue of Morphine , the principal alkaloid of opium. |
| Molecular Formula | C17H16D3NO3 |
| CAS# | 67293-88-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@H](C=C[C@@]1([H])[C@@]2([H])CC3=CC=C4O)[C@@]5([H])[C@]1(CCN2C([2H])([2H])[2H])C3=C4O5 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST57101.html |
| Additional Information | NULL |