Kif15-IN-2
potent Kif15 kinesin inhibitor Cell Cycle/Checkpoint|Kinesin
| Catalog Number | B3281-5 |
| Research Area | Cell Cycle/Checkpoint|Kinesin |
| Molecular Formula | C20H20N6O4S |
| CAS# | 672926-33-9 |
| Purity | 98% |
| SMILES | CC([C@@](N1C(C2=CC=CC=C2N=C1O)=O)([H])/C(O)=N/C3=NC(C)=C(S3)C4=NN=C(O4)C)C |
| Size | 5mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B3281 |
