Kif15-IN-1
potent Kif15 kinesin inhibitor Cell Cycle/Checkpoint|Kinesin
| Catalog Number | B3280-1000 |
| Research Area | Cell Cycle/Checkpoint|Kinesin |
| Molecular Formula | C20H22N4O5S |
| CAS# | 672926-32-8 |
| Purity | 98% |
| SMILES | CCOC(C(S1)=C(N=C1/N=C(O)/[C@](N2C(C3=CC=CC=C3N=C2O)=O)([H])C(C)C)C)=O |
| Size | 1g |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B3280 |
