Fenoldopam
Fenoldopam (SKF 82526) is a selective dopamine-1 (DA1) receptor agonist with natriuretic/diuretic properties with EC50 of 55.5 nM in stimulating cAMP accumulation in LLC-PK1 cells, which is more potent than DA .
| Trivial name | SKF 82526 |
| Catalog Number | S2089 |
| Molecular Formula | C16H16ClNO3 |
| CAS# | 67227-56-9 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | OC1=CC=C(C=C1)C2CNCCC3=C(Cl)C(=C(O)C=C23)O |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/fenoldopam-corlopam.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s2089-fenoldopam-chemical-structure.gif |