Gliotoxin
API Standard
| Catalog Number | CS-O-05647 |
| Alternative Name(s) | GLAHYDRO-6-HYDROXY-3(HYROXYMETHYL)-2-METHYL-10H-3A;10A-EPIDITHIO-PYRAZINOL[1,2ALPHA]INDOLE-1,4-DIONE;(3R,5aS,6S,10aR)-2,3,5a,6-Tetrahydro-6-hydroxy-3-(hydroxymethyl)-2-methyl-10H-3,10a-epidithiopyrazino[1,2-a]indole-1,4-dione |
| Research Area | Gliotoxin is a sulfur-containing mycotoxin produced by species of fungi and pathogens of humans. Gliotoxin exhibits inhibitory activities against histone H3K9 methyltransferase, a key enzyme in the re gulation of transcriptional activity by writing epigen |
| Molecular Formula | C13H14N2O4S2 |
| CAS# | 67-99-2 |
| Purity | >98% |
| SMILES | O=C(N1C)[C@@](C2)(SS[C@]1(CO)C3=O)N3[C@@]4([H])C2=CC=C[C@@H]4O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO05647.html |