Thiamine Hydrochloride
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-30783 |
| Alternative Name(s) | Thiamine Hydrochloride;THIAMINE HYDROCHLORIDE; Aneurine hydrochloride; 67-03-8; Thiamine HCL; Vitamin B1 hydrochloride; Thiamin chloride; |
| Research Area | Thiamine Hydrochloride is the hydrochloride salt form of thiamine, a vitamin essential for aerobic metabolism, cell growth, transmission of nerve impulses and acetylcholine synthesis. Upon hydrolysis, thiamine hydrochloride is phosphorylated by thiamine d |
| Molecular Formula | C12H17ClN4OSHCl |
| CAS# | 67-03-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC1=C(CCO)SC=[N+]1CC2=CN=C(C)N=C2N.[Cl-].Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30783.html |
| Additional Information | NULL |