Ipratropium bromide monohydrate
Ipratropium bromide is a muscarinic antagonist structurally related to ATROPINE but often considered safer and more effective for inhalation use. It is used for various bronchial disorders, in rhinitis, and as an antiarrhythmic.
| Catalog Number | T0098 |
| Alternative Name(s) | Ipratropium bromide hydrate |
| Research Area | Neuroscience |
| Molecular Formula | C20H32BrNO4 |
| CAS# | 66985-17-9 |
| SMILES | O.[Br-].CC(C)[N+]1(C)[C@H]2CC[C@@H]1C[C@@H](C2)OC(=O)C(CO)c1ccccc1 |
| Size | 25 mg |
| Supplier Page | https://www.targetmol.com/compound/Ipratropium bromide monohydrate |
| Additional Information | https://www.targetmol.com/datasheet/T0098 |
