Ipratropium bromide monohydrate
Ipratropium bromide (Atrovent, Sch 1000) monohydrate is an antagonist of muscarinic acetylcholine receptors (mAChR) with IC50 of 2.9 nM, 2.0 nM, and 1.7 nM for M1, M2, and M3 receptors, respectively.
| Trivial name | Atrovent, Sch 1000 monohydrate |
| Catalog Number | S5777 |
| Molecular Formula | C20H32BrNO4 |
| CAS# | 66985-17-9 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | O.[Br-].CC(C)[N+]1(C)C2CCC1CC(C2)OC(=O)C(CO)C3=CC=CC=C3 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/ipratropium-bromide-monohydrate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s5777-ipratropium-bromide-monohydrate-chemical-structure.gif |