Ipratropium Bromide
API Standard
| Catalog Number | CS-O-01686 |
| Alternative Name(s) | 3-((3-hydroxy-2-phenylpropanoyl)oxy)-8-isopropyl-8-methyl-8-azabicyclo[3.2.1]octan-8-ium bromide; 60205-81-4; 22254-24-6. |
| Research Area | A muscarinic antagonist structurally related to ATROPINE but often considered safer and more effective for inhalation use. It is used for various bronchial disorders, in rhinitis, and as an antiarrhythmic. |
| Molecular Formula | C20H30BrNO3 |
| CAS# | 66985-17-9 |
| Purity | >98% |
| SMILES | CC([N@+]1([C@H]2C[C@H](OC(C(C3=CC=CC=C3)CO)=O)C[C@@H]1CC2)C)C.[Br-] |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01686.html |