Linagliptin (BI-1356) 10mM * 1mL in DMSO
Linagliptin is a DPP-4 inhibitor, an enzyme that degrades the incretin hormones glucagon-like peptide-1 (GLP-1) and glucose-dependent insulinotropic polypeptide (GIP).
| Trivial name | Linagliptin (BI-1356) 10mM * 1mL in DMSO |
| Catalog Number | A11224-10mM-D |
| Alternative Name(s) | 8-[(3R)-3-Amino-1-piperidinyl]-7-(2-butynyl)-3,7-dihydro-3-methyl-1-[(4-methyl-2-quinazolinyl)methyl]-1H-purine-2,6-dione |
| Molecular Formula | C25H28N8O2 |
| CAS# | 668270-12-0 |
| SMILES | CC#CCN1C2=C(N=C1N3CCC[C@H](C3)N)N(C(=O)N(C2=O)CC4=NC5=CC=CC=C5C(=N4)C)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/linagliptin.html |
