Apraclonidine
Apraclonidine is a clonidine derivative with selective alpha-2-adrenergic agonistic activity. Upon ocular administration, apraclonidine enhances aqueous humor uveoscleral outflow and decreases aqueous production by vasoconstriction. This may decrease intraocular pressure (IOP).
| Trivial name | / |
| Catalog Number | CSN10322 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C9H10Cl2N4 |
| CAS# | 66711-21-5 |
| Purity | ≥98% |
| SMILES | NC1=CC(Cl)=C(NC2=NCCN2)C(Cl)=C1 |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/apraclonidine.html |