E-64 10mM * 1mL in DMSO
E-64 is an irreversible and selective cysteine protease inhibitor with IC50 of 9 nM for papain.
Trivial name | E-64 10mM * 1mL in DMSO |
Catalog Number | A13257-10mM-D |
Alternative Name(s) | 3-?[[[(1S)-?1-?[[[4-?[(aminoiminomethyl)amino]butyl]amino]carbonyl]-?3-?methylbutyl]amino]carbonyl]-?(2S,?3S)-?oxiranecarboxylic acid |
Molecular Formula | C15H27N5O5 |
CAS# | 66701-25-5 |
SMILES | CC(C)C[C@@H](C(=O)NCCCCN=C(N)N)NC(=O)[C@@H]1[C@H](O1)C(=O)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/e-64.html |