TAC(TERT activator compound)
TAC(TERT activator compound) is an activator of TERT, that upregulates TERT transcription via the MEK/ERK/AP-1 cascade. It enhances telomere synthesis, reduces aging markers, inflammation, and senescence, and preserves brain function, highlighting TERT’s potential in combating aging and related diseases.
| Trivial name | TERT activator compound |
| Catalog Number | E4660 |
| Molecular Formula | C18H13F2NO3 |
| CAS# | 666699-46-3 |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(CC(=O)C3=C(C=C(C=C3)F)F)C(=O)O |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/tac-tert-activator-compound.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E4660-TAC-TERT-activator-compound-chemical-structure.png |
