(E)-Ethyl Dihydroxycinnamate
Ethyl caffeate, a natural product isolated and purified from the roots of Ferula assafoetida L., has anti-inflammatory activity, and strongly inhibits neoplastic transformation of JB6 Cl41 cells without toxicity.
| Trivial name | (E)-Ethyl 3,4-Dihydroxycinnamate |
| Catalog Number | CSN10953 |
| Alternative Name(s) | (E)-Ethyl 3,4-Dihydroxycinnamate |
| Research Area | / |
| Molecular Formula | C11H12O4 |
| CAS# | 66648-50-8 |
| Purity | ≥98% |
| SMILES | O=C(OCC)/C=C/C1=CC=C(O)C(O)=C1 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/(e)-ethyl-dihydroxycinnamate.html |