Biotin Hydrazide 250mg
Biotin hydrazide is a biotinyl derivative that can be used as a probe for the determination of protein carbonylation, which is a component of several diseases.
| Trivial name | Biotin Hydrazide 250mg |
| Catalog Number | A14035-250 |
| Alternative Name(s) | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanehydrazide |
| Molecular Formula | C10H18N4O2S |
| CAS# | 66640-86-6 |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NN)NC(=O)N2 |
| Size | 250mg |
| Supplier Page | http://www.adooq.com/biotin-hydrazide.html |