O-Acetyl-L-serine hydrochloride
O-Acetyl-L-serine (OAS, O-Acetylserine, O-Acetyl-L-serine) hydrochloride (HCl) is an intermediate in the biosynthesis of the amino acid cysteine in bacteria and plants that displays a signalling function leading to changes in transcript levels of a specific gene set irrespective of the sulfur status of the plant.
| Trivial name | OAS HCl, O-Acetylserine HCl, O-Acetyl-L-serine HCl |
| Catalog Number | S3348 |
| Molecular Formula | C15H18N4O5 |
| CAS# | 66638-22-0 |
| Inchi | InChI=1S/C15H18N4O5/c1-5-9(16)12(21)8-6(4-24-14(17)22)15(23-2)13-7(18-13)3-19(15)10(8)11(5)20/h6-7,13,18H,3-4,16H2,1-2H3,(H2,17,22)/t6-,7+,13+,15-/m1/s1 |
| Inchi Key | NWIBSHFKIJFRCO-WUDYKRTCSA-N |
| SMILES | CC1=C(C(=O)C2=C(C1=O)N3CC4C(C3(C2COC(=O)N)OC)N4)N |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/o-acetyl-l-serine-hydrochloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s3348-o-acetyl-l-serine-hydrochloride-chemical-structure.gif |