Ansamitocin P-3
Ansamitocin P-3, which is used as an antibody drug conjugate cytotoxin is a maytansine analog which displays potent cytotoxicity against the human solid tumor cell lines A-549 and HT-29.
| Trivial name | Antibiotic C 15003P3; Maytansinol Butyrate; C15003P3 |
| Catalog Number | CSN18377 |
| Alternative Name(s) | Antibiotic C 15003P3; Maytansinol Butyrate; C15003P3 |
| Research Area | Cancer |
| Molecular Formula | C32H43ClN2O9 |
| CAS# | 66584-72-3 |
| Purity | ≥99% |
| SMILES | ClC1=C(N(C)C(C[C@H](OC(C(C)C)=O)[C@@](O2)(C)[C@]2([H])[C@H](C)[C@]3([H])C[C@](NC(O3)=O)(O)[C@H](OC)/C=C/C=C(C)/C4)=O)C=C4C=C1OC |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/ansamitocin-p-3.html |