TGX-221
TGX-221 is a p110β-specific inhibitor with IC50 of 5 nM in a cell-free assay, 1000-fold more selective for p110β than p110α.
| Trivial name | N/A |
| Catalog Number | S1169 |
| Molecular Formula | C15H18N2O9 |
| CAS# | 663619-89-4 |
| Inchi | InChI=1S/C15H18N2O9/c1-7(18)23-6-10-12(24-8(2)19)13(25-9(3)20)14(26-10)17-5-4-11(21)16-15(17)22/h4-5,10,12-14H,6H2,1-3H3,(H,16,21,22)/t10-,12-,13-,14-/m1/s1 |
| Inchi Key | AUFUWRKPQLGTGF-FMKGYKFTSA-N |
| SMILES | CC(=O)OCC1C(C(C(O1)N2C=CC(=O)NC2=O)OC(=O)C)OC(=O)C |
| Size | 10mM/1mL |
| Supplier Page | http://www.selleckchem.com/products/TGX-221.html |
| Additional Information | https://file.selleck.cn/downloads/struct/TGX-221-chemical-structure-S1169.gif |
