ML171
ML171 is a novel and selective NOX1 inhibitor with IC50 value of 0.25 μM for blocking NOX1-dependent ROS generation in a HEK293-NOX1 recombinant cell system.
| Trivial name | 2-Acetylphenothiazine; 2-APT |
| Catalog Number | CSN21291 |
| Alternative Name(s) | 2-Acetylphenothiazine; 2-APT |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C14H11NOS |
| CAS# | 6631-94-3 |
| Purity | ≥98% |
| SMILES | CC(C(C=C1N2)=CC=C1SC3=C2C=CC=C3)=O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/ml171.html |
