N-Desmethyl-loperamide | MedChemExpress (MCE)
N-Desmethyl-loperamide is a major metabolite of loperamide, a drug that selectively activates peripheral μopioid receptors with a Ki value of 0.16 nM. N-Desmethyl-loperamide is a substrate of the ATP-dependent efflux transporter P-glycoprotein[1][2][3].
| Trivial name | N-Desmethyl-loperamide |
| Catalog Number | HY-128038 |
| Research Area | Neurological Disease |
| CAS# | 66164-07-6 |
| Purity | ≥98.0% |
| SMILES | O=C(C(C1=CC=CC=C1)(CCN2CCC(C3=CC=C(C=C3)Cl)(CC2)O)C4=CC=CC=C4)NC |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/n-desmethyl-loperamide.html |