Arachidonic acid sodium salt | MedChemExpress (MCE)
Arachidonic acid (Immunocytophyt) sodium salt is a polyunsaturated omega-6 fatty acid and a major constituent of biomembranes. Arachidonic acid sodium salt also acts as the substrate for various lipid mediators, such as prostaglandins (PGs). Arachidonic acid sodium salt improves cognitive response and cardiovascular function[1].

Trivial name | Arachidonic acid sodium salt |
Catalog Number | HY-109590A |
Alternative Name(s) | Immunocytophyt sodium salt |
Research Area | Neurological Disease; Inflammation/Immunology; Cardiovascular Disease |
CAS# | 6610-25-9 |
Purity | ≥98.0% |
SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(O[Na])=O |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/arachidonic-acid-sodium-salt.html |