Nimodipine
Nimodipine is a dihydropyridine derivative and an analogue of the calcium channel blocker nifedipine, with antihypertensive activity. Nimodipine decreases intracellular free Ca2+,Beclin-1 and autophagy.
| Trivial name | BAY E 9736 |
| Catalog Number | CSN12874 |
| Alternative Name(s) | BAY E 9736 |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C21H26N2O7 |
| CAS# | 66085-59-4 |
| Purity | ≥99% |
| SMILES | O=C(C1=C(C)NC(C)=C(C(OC(C)C)=O)C1C2=CC=CC([N+]([O-])=O)=C2)OCCOC |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/nimodipine.html |