Psoralen
Psoralen is the simplest member of the class of psoralens that is 7H-furo[3,2-g]chromene having a keto group at position 7. It has been found in plants like Psoralea corylifolia and Ficus salicifolia. It has a role as a plant metabolite.
| Catalog Number | PIPE-0552 |
| Alternative Name(s) | Ficusin 7H-Furo[3,2-g]chromen-7-one Furocoumarin |
| Research Area | Natural Extract |
| Molecular Formula | C11H6O3 |
| CAS# | 66-97-7 |
| SMILES | C1=CC(=O)OC2=CC3=C(C=CO3)C=C21 |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/psoralen-item-9491.html |