Cycloheximide 200mg
Cycloheximide (also known as actidione) is used as an selective antibiotic. It inhibits the protein synthesis (DNA-dependent RNA) of saprobic fungi eukaryotes. by binding with the 80S ribosome, while inactive against dermatophytes and systemic fungi.
| Trivial name | Cycloheximide 200mg |
| Catalog Number | A10036-200 |
| Alternative Name(s) | 4-[(2R)-2-[(1S,3S,5S)-3,5-Dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]piperidine-2,6-dione |
| Molecular Formula | C15H23NO4 |
| CAS# | 66-81-9 |
| SMILES | C[C@H]1C[C@@H](C(=O)[C@@H](C1)[C@@H](CC2CC(=O)NC(=O)C2)O)C |
| Size | 200mg |
| Supplier Page | http://www.adooq.com/cycloheximide-actidione.html |
