o-Phenanthroline
o-Phenanthroline (1,10-Phenanthroline), a metal chelator, prevents the induction of chromosomal aberrations in streptozotocin-treated cells. o-Phenanthroline (1,10-Phenanthroline) forms a red chelate with Fe2+ that absorbs maximally at 510 nm[1].
| Trivial name | 1,10-Phenanthroline |
| Catalog Number | CSN25445 |
| Alternative Name(s) | 1,10-Phenanthroline |
| Research Area | Cancer |
| Molecular Formula | C12H8N2 |
| CAS# | 66-71-7 |
| Purity | ≥99% |
| SMILES | C1=CC3=C(C2=NC=CC=C12)N=CC=C3 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/o-phenanthroline.html |