Dienogest D8
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-32607 |
| Alternative Name(s) | Dienogestril-D8; Dinagest-D8; (17α)-17-Hydroxy-3-oxo-19-norpregna-4,9-diene-21-nitrile-d8; 17α-Cyanomethyl-17β-hydroxyestra-4, 9-dien-3-one-d5; Dienogestril-d8; Endometrion-d8; STS 557-d8 |
| Research Area | Dienogest-d8 (major) is labelled derivative of 19-Nortestosterone. It is used in combination with estrogen as oral contraceptive |
| Molecular Formula | C20H17D8NO2 |
| CAS# | 65928-58-7 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@](CC1([2H])[2H])([C@]([H])([C@@]([2H])(C1=C2CC3([2H])[2H])CCC2=C(C3=O)[2H])CC4)[C@@]4(C([2H])(C#N)[2H])O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO32607.html |
| Additional Information | NULL |