Tioconazole 10mM * 1mL in DMSO
Tioconazole is an antifungal medication of the imidazole class used to treat infections caused by a fungus or yeast.
| Trivial name | Tioconazole 10mM * 1mL in DMSO |
| Catalog Number | A11655-10mM-D |
| Alternative Name(s) | (RS)-1-[2-[(2-Chloro-3-thienyl)methoxy]-2-(2,4-dichlorophenyl)ethyl]-1H-imidazole |
| Molecular Formula | C16H13Cl3N2OS |
| CAS# | 65899-73-2 |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(CN2C=CN=C2)OCC3=C(SC=C3)Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/tioconazole.html |
