Chlordiazepoxide D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-57084 |
| Alternative Name(s) | 7-Chloro-N-methyl-5-(phenyl-d5)-3H-1,4-benzodiazepin-2amine-4-oxide; Azepoxide-ditabs-d5; Multum-d5; Risolid-d5;; (2E)-7-chloro-2-(methylimino)-5-[(2,3,4,5,6-D5)phenyl]-3,4-dihydro-2H-1,4-benzodiazepin-4-ol |
| Research Area | Controlled substance (depressant). Anxiolytic. Prototype of the benzodiazepine anxiolytics. |
| Molecular Formula | C16H9D5ClN3O |
| CAS# | 65891-81-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[N]1=C(C(C([2H])=C2[2H])=C(C([2H])=C2[2H])[2H])C3=CC(Cl)=CC=C3N=C(NC)C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST57084.html |
| Additional Information | NULL |