Phenytoin D10
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02749 |
| Alternative Name(s) | 5,5-bis[(2,3,4,5,6-D5)phenyl]imidazolidine-2,4- dione;CS-BU-00099 |
| Research Area | Labeled Phenytoin, intended for use as an internal standard for the quantification of Phenytoin by GC- or LC-mass spectrometry. |
| Molecular Formula | C15D10H2N2O2 |
| CAS# | 65854-97-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N1)C(C(C([2H])=C2[2H])=C(C([2H])=C2[2H])[2H])(C(C([2H])=C3[2H])=C(C([2H])=C3[2H])[2H])NC1=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02749.html |
| Additional Information | NULL |