AG-1024 (Tyrphostin) 10mg
AG-1024 (Tyrphostin) is a specific inhibitor of insulin-like growth factor-1 (IGF-1) and insulin receptor tyrosine kinase activity. Exhibits lower IC50 values for IGF-1 than for the insulin receptor. Also inhibits insulin-stimulated cellular proliferation.
Trivial name | AG-1024 (Tyrphostin) 10mg |
Catalog Number | A11400-10 |
Alternative Name(s) | [3-bromo-5-(1,1-dimethylethyl)-4-hydroxyphenyl]methylene |
Molecular Formula | C14H13BrN2O |
CAS# | 65678-07-1 |
SMILES | CC(C)(C)C1=C(C(=CC(=C1)C=C(C#N)C#N)Br)O |
Size | 10mg |
Supplier Page | http://www.adooq.com/ag-1024-tyrphostin.html |