Silymarin (Silybin B) 10mM * 1mL in DMSO
Silymarin (Silibinin B) inhibits chemically induced urinary bladder tumor growth and progression possibly by inhibiting cell proliferation and enhancing apoptosis.
| Trivial name | Silymarin (Silybin B) 10mM * 1mL in DMSO |
| Catalog Number | A10844-10mM-D |
| Alternative Name(s) | N/A |
| Molecular Formula | C25H22O10 |
| CAS# | 65666-07-1 |
| SMILES | COC1=C(C=CC(=C1)C2C(OC3=C(O2)C=C(C=C3)C4C(C(=O)C5=C(C=C(C=C5O4)O)O)O)CO)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/silymarin-silybin-b.html |